CAS 85160-84-5 appears in our catalog under these names: 2,2-Dimethyl-6-nitro-2h-benzo[b][1,4]oxazin-3(4h)-one, 95%, 2,2–Dimethyl–6–nitro–2H–benzo(b)(1,4)oxazin–3(4h)–one, 2,2-Dimethyl-6-nitro-2H-1,4-benzoxazin-3(4H)-one, 97% , 2,2-DIMETHYL-6-NITRO-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 1g, 5g, 100mg, 10g, 25g.
2,2-dimethyl-6-nitro-4H-1,4-benzoxazin-3-one (CAS 85160-84-5) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: 2,2-dimethyl-6-nitro-4H-1,4-benzoxazin-3-one. InChIKey: YKXZRZGZJZYBBH-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 2,2-dimethyl-6-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | YKXZRZGZJZYBBH-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)C=CC(=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)