cas: 85160-83-4 — see every product listed under this CAS number, including other names
2,2-Dimethyl-7-nitro-2H-benzo(b)(1,4)oxazin-3(4H)-one, 95% (CAS 85160-83-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A217086-250mg |
| cas | 85160-83-4 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 154.63 Pln | |
| AmBeed | 1g | 388.99 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,2-dimethyl-7-nitro-4H-1,4-benzoxazin-3-one (CAS 85160-83-4) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: 2,2-dimethyl-7-nitro-4H-1,4-benzoxazin-3-one. InChIKey: KGWYDVZSGRHPFK-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 2,2-dimethyl-7-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | KGWYDVZSGRHPFK-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)C=C(C=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)