cas: 7117-31-9 — see every product listed under this CAS number, including other names
2,2-Dioxo-1-methyl-2,1-benzothiazin-4(3H)-one (CAS 7117-31-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F017154-250MG |
| cas | 7117-31-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 502.97 Pln |
| delivery time | 2-3 weeks |
|---|
1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one (CAS 7117-31-9) is a chemical compound with the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. IUPAC name: 1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one. InChIKey: SLAAUAZTLUBBDB-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | 1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one |
| InChIKey | SLAAUAZTLUBBDB-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=O)CS1(=O)=O |
Computed by PubChem (NCBI)