Products 68762-59-4
CAS 68762-59-4 is the registry number for 2-(Acetylamino)-3-(2-thienyl)-2-propenoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 5g, 250mg, 10g, 1g.
(Z)-2-acetamido-3-thiophen-2-ylprop-2-enoic acid (CAS 68762-59-4) is a chemical compound with the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. IUPAC name: (Z)-2-acetamido-3-thiophen-2-ylprop-2-enoic acid. InChIKey: GIYLBBHMKLRLOF-YVMONPNESA-N.
| Molecular formula | C9H9NO3S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | (Z)-2-acetamido-3-thiophen-2-ylprop-2-enoic acid |
| InChIKey | GIYLBBHMKLRLOF-YVMONPNESA-N |
| SMILES | CC(=O)N/C(=C\C1=CC=CS1)/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(acetylamino)-3-(2-thienyl)-2-propenoic acid, (Z)-2-acetamido-3-thiophen-2-ylprop-2-enoic acid, 2-Propenoic acid, 2-(acetylamino)-3-(2-thienyl)-, (Z)-, (2Z)-2-(acetylamino)-3-thien-2-ylacrylic acid, (Z)-2-Acetamido-3-(thiophen-2-yl)acrylic acid, (Z)-2-acetamido-3-(2-thienyl)prop-2-enoic acid