Products 197236-53-6
CAS 197236-53-6 is the registry number for 2-[(2-Amino-2-oxoethyl)thio]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(2-amino-2-oxoethyl)sulfanylbenzoic acid (CAS 197236-53-6) is a chemical compound with the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. IUPAC name: 2-(2-amino-2-oxoethyl)sulfanylbenzoic acid. InChIKey: CTLJJQVIQIPRFS-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | 2-(2-amino-2-oxoethyl)sulfanylbenzoic acid |
| InChIKey | CTLJJQVIQIPRFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)SCC(=O)N |
Computed by PubChem (NCBI)
Synonyms:
2-[(2-amino-2-oxoethyl)thio]benzoic acid, 2-[(carbamoylmethyl)sulfanyl]benzoic acid, 2-(2-amino-2-oxoethyl)sulfanylbenzoic acid, 2-((2-amino-2-oxoethyl)thio)benzoic acid, 2-((2-amino-2-oxoethyl)thio)benzoicacid, 2-(2-amino-2-oxo-ethyl)sulfanylbenzoic acid, 2-[(2-amino-2-oxoethyl)sulfanyl]benzoic acid