CAS 850429-63-9 appears in our catalog under these names: 6-Methylsulfonyloxindole, 98%, 6-(Methylsulfonyl)indolin-2-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.
6-methylsulfonyl-1,3-dihydroindol-2-one (CAS 850429-63-9) is a chemical compound with the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. IUPAC name: 6-methylsulfonyl-1,3-dihydroindol-2-one. InChIKey: DEQZMOXYEJGJJN-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | 6-methylsulfonyl-1,3-dihydroindol-2-one |
| InChIKey | DEQZMOXYEJGJJN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(CC(=O)N2)C=C1 |
Computed by PubChem (NCBI)