Products 18712-15-7
CAS 18712-15-7 is the registry number for O-Ethylsaccharin. Offered by: TRC. Available pack sizes: 250mg.
3-ethoxy-1,2-benzothiazole 1,1-dioxide (CAS 18712-15-7) is a chemical compound with the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. IUPAC name: 3-ethoxy-1,2-benzothiazole 1,1-dioxide. InChIKey: ZTDNTGGXSZLIEO-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | 3-ethoxy-1,2-benzothiazole 1,1-dioxide |
| InChIKey | ZTDNTGGXSZLIEO-UHFFFAOYSA-N |
| SMILES | CCOC1=NS(=O)(=O)C2=CC=CC=C21 |
Computed by PubChem (NCBI)
Synonyms:
3-Ethoxy-1H-1lambda~6~,2-benzothiazole-1,1-dione, 3-Ethoxybenzo[d]isothiazole 1,1-dioxide, 3-ethoxy-1,2-benzothiazole 1,1-dioxide, O-Ethylsaccharin, 3-Ethoxy-1,2-benzothiazole-1,1-dioxide, 3-Ethoxybenzo[d]isothiazole1,1-dioxide, 3-Ethoxy-benzo[d]isothiazole 1,1-dioxide, 3-Ethoxy 1,2-benzisothiazole 1,1-dioxide, Cambridge id 7112569, 3-ethoxy-1,2-benzothiazole-1,1-dione