CAS 132276-87-0 appears in our catalog under these names: 2-(4-Methoxybenzenesulfonyl)acetonitrile, 90%, 2-(4-Methoxybenzenesulfonyl)acetonitrile, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2-(4-methoxyphenyl)sulfonylacetonitrile (CAS 132276-87-0) is a chemical compound with the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. IUPAC name: 2-(4-methoxyphenyl)sulfonylacetonitrile. InChIKey: WSKDIKKGBGYFLB-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)sulfonylacetonitrile |
| InChIKey | WSKDIKKGBGYFLB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)CC#N |
Computed by PubChem (NCBI)