Products 90564-11-7

CAS 90564-11-7 is the registry number for 5-(((2-Cyanoethyl)thio)methyl)furan-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(2-cyanoethylsulfanylmethyl)furan-2-carboxylic acid (CAS 90564-11-7) is a chemical compound with the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. IUPAC name: 5-(2-cyanoethylsulfanylmethyl)furan-2-carboxylic acid. InChIKey: KXHJJUBTIZNZRR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO3S
Molecular weight211.24 g/mol
IUPAC name5-(2-cyanoethylsulfanylmethyl)furan-2-carboxylic acid
InChIKeyKXHJJUBTIZNZRR-UHFFFAOYSA-N
SMILESC1=C(OC(=C1)C(=O)O)CSCCC#N

Computed by PubChem (NCBI)