CAS 170492-47-4 appears in our catalog under these names: 1-Hydroxy-6-(methylsulfonyl)indole, 95%, 6-(Methylsulfonyl)-1H-indol-1-ol, 95+%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g.
1-hydroxy-6-methylsulfonylindole (CAS 170492-47-4) is a chemical compound with the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. IUPAC name: 1-hydroxy-6-methylsulfonylindole. InChIKey: DSXUTUMPWBBNSD-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | 1-hydroxy-6-methylsulfonylindole |
| InChIKey | DSXUTUMPWBBNSD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)C=CN2O |
Computed by PubChem (NCBI)