CAS 7117-31-9 appears in our catalog under these names: 2,2-Dioxo-1-methyl-2,1-benzothiazin-4(3h)-one, 95%, 1-Methyl-1,2,3,4-tetrahydro-2lambda~6~,1-benzothiazine-2,2,4-trione, 2,2-Dioxo-1-methyl-2,1-benzothiazin-4(3H)-one. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one (CAS 7117-31-9) is a chemical compound with the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. IUPAC name: 1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one. InChIKey: SLAAUAZTLUBBDB-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | 1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one |
| InChIKey | SLAAUAZTLUBBDB-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=O)CS1(=O)=O |
Computed by PubChem (NCBI)