2,3-Dichloro-4-methoxyphenylboronic acid, 98%, 98%
cas: 1190219-72-7 — see every product listed under this CAS number, including other names
2,3-Dichloro-4-methoxyphenylboronic acid, 98%, 98% (CAS 1190219-72-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111P3B-100mg |
| cas | 1190219-72-7 |
| size | 100mg |
| availability | 3g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 693.20 Pln | |
| Chemat | 1g | 1403.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,3-dichloro-4-methoxyphenyl)boronic acid (CAS 1190219-72-7) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (2,3-dichloro-4-methoxyphenyl)boronic acid. InChIKey: FBELHXIPMFECAK-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (2,3-dichloro-4-methoxyphenyl)boronic acid |
| InChIKey | FBELHXIPMFECAK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OC)Cl)Cl)(O)O |
Computed by PubChem (NCBI)