cas: 186517-27-1 — see every product listed under this CAS number, including other names
2,3-Dichloro-6-(trifluoromethyl)benzaldehyde 98% (CAS 186517-27-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A452331-250mg |
| cas | 186517-27-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 515.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A452331 |
2,3-dichloro-6-(trifluoromethyl)benzaldehyde (CAS 186517-27-1) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 2,3-dichloro-6-(trifluoromethyl)benzaldehyde. InChIKey: QCYGNWQELPOXBL-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 2,3-dichloro-6-(trifluoromethyl)benzaldehyde |
| InChIKey | QCYGNWQELPOXBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)C=O)Cl)Cl |
Computed by PubChem (NCBI)