Products 134741-65-4
CAS 134741-65-4 appears in our catalog under these names: 2,6-Dichloro-3-(trifluoromethyl)benzaldehyde, 95%, 2,6-Dichloro-3-(trifluoromethyl)benzaldehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g.
2,6-dichloro-3-(trifluoromethyl)benzaldehyde (CAS 134741-65-4) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 2,6-dichloro-3-(trifluoromethyl)benzaldehyde. InChIKey: MARVQTJKYZMKTO-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 2,6-dichloro-3-(trifluoromethyl)benzaldehyde |
| InChIKey | MARVQTJKYZMKTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)Cl)C=O)Cl |
Computed by PubChem (NCBI)