CAS 1686130-35-7 is the registry number for 3,4-Dichloro-5-(trifluoromethyl)benzaldehyde, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
3,4-dichloro-5-(trifluoromethyl)benzaldehyde (CAS 1686130-35-7) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 3,4-dichloro-5-(trifluoromethyl)benzaldehyde. InChIKey: JUPNFMGKWKVUBY-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 3,4-dichloro-5-(trifluoromethyl)benzaldehyde |
| InChIKey | JUPNFMGKWKVUBY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)Cl)C=O |
Computed by PubChem (NCBI)