Products 320-84-3
CAS 320-84-3 appears in our catalog under these names: 5-Chloro-2-(trifluoromethyl)benzoyl chloride, 95%, 5-Chloro-2-(trifluoromethyl)benzoyl chloride. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 25g.
5-chloro-2-(trifluoromethyl)benzoyl chloride (CAS 320-84-3) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 5-chloro-2-(trifluoromethyl)benzoyl chloride. InChIKey: HSKPEPFDFCWQGY-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 5-chloro-2-(trifluoromethyl)benzoyl chloride |
| InChIKey | HSKPEPFDFCWQGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)