CAS 98187-13-4 appears in our catalog under these names: 4-Chloro-2-(trifluoromethyl)benzoyl chloride, 95%, 4-Chloro-2-(trifluoromethyl)benzoyl chloride 98+%, 4-Chloro-2-(trifluoromethyl)benzoyl chloride, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg.
4-chloro-2-(trifluoromethyl)benzoyl chloride (CAS 98187-13-4) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 4-chloro-2-(trifluoromethyl)benzoyl chloride. InChIKey: SBWSLWFNEXVAAY-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 4-chloro-2-(trifluoromethyl)benzoyl chloride |
| InChIKey | SBWSLWFNEXVAAY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)C(=O)Cl |
Computed by PubChem (NCBI)