Products 98187-13-4

CAS 98187-13-4 appears in our catalog under these names: 4-Chloro-2-(trifluoromethyl)benzoyl chloride, 95%, 4-Chloro-2-(trifluoromethyl)benzoyl chloride 98+%, 4-Chloro-2-(trifluoromethyl)benzoyl chloride, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-chloro-2-(trifluoromethyl)benzoyl chloride (CAS 98187-13-4) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 4-chloro-2-(trifluoromethyl)benzoyl chloride. InChIKey: SBWSLWFNEXVAAY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3Cl2F3O
Molecular weight243.01 g/mol
IUPAC name4-chloro-2-(trifluoromethyl)benzoyl chloride
InChIKeySBWSLWFNEXVAAY-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)C(F)(F)F)C(=O)Cl

Computed by PubChem (NCBI)