CAS 657-05-6 appears in our catalog under these names: 2-Chloro-5-(trifluoromethyl)benzoyl chloride, 95%, 2–Chloro–5–(trifluoromethyl)benzoyl chloride, 2-Chloro-5-(trifluoromethyl)benzoyl chloride 97%, 2-Chloro-5-(trifluoromethyl)benzoyl chloride, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg.
2-chloro-5-(trifluoromethyl)benzoyl chloride (CAS 657-05-6) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 2-chloro-5-(trifluoromethyl)benzoyl chloride. InChIKey: FRARPACTAFPNNL-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethyl)benzoyl chloride |
| InChIKey | FRARPACTAFPNNL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(=O)Cl)Cl |
Computed by PubChem (NCBI)