Products 1735-55-3

CAS 1735-55-3 is the registry number for 4-Chloro-3-(trifluoromethyl)benzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-chloro-3-(trifluoromethyl)benzoyl chloride (CAS 1735-55-3) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 4-chloro-3-(trifluoromethyl)benzoyl chloride. InChIKey: ODPJRBXAGAUQAW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3Cl2F3O
Molecular weight243.01 g/mol
IUPAC name4-chloro-3-(trifluoromethyl)benzoyl chloride
InChIKeyODPJRBXAGAUQAW-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)Cl)C(F)(F)F)Cl

Computed by PubChem (NCBI)