CAS 886496-83-9 appears in our catalog under these names: 3-Chloro-5-(trifluoromethyl)benzoyl chloride, 95%, 3-Chloro-5-(trifluoromethyl)benzoyl chloride, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g.
3-chloro-5-(trifluoromethyl)benzoyl chloride (CAS 886496-83-9) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 3-chloro-5-(trifluoromethyl)benzoyl chloride. InChIKey: CPGKYJRZLOSIDS-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 3-chloro-5-(trifluoromethyl)benzoyl chloride |
| InChIKey | CPGKYJRZLOSIDS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)Cl)C(=O)Cl |
Computed by PubChem (NCBI)