Products 916420-44-5

CAS 916420-44-5 appears in our catalog under these names: 2-Chloro-6-(trifluoromethyl)benzoyl chloride, 97%, 2–Chloro–6–(trifluoromethyl)benzoyl chloride, 2-Chloro-6-(trifluoromethyl)benzoyl chloride 98%, 2-Chloro-6-(trifluoromethyl)benzoyl chloride. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g, 10g.

Structural formula: {0} (CAS {1})

2-chloro-6-(trifluoromethyl)benzoyl chloride (CAS 916420-44-5) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)benzoyl chloride. InChIKey: ZGPUACVHATTXEX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3Cl2F3O
Molecular weight243.01 g/mol
IUPAC name2-chloro-6-(trifluoromethyl)benzoyl chloride
InChIKeyZGPUACVHATTXEX-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)C(=O)Cl)C(F)(F)F

Computed by PubChem (NCBI)