cas: 1092353-03-1 — see every product listed under this CAS number, including other names
2,3-Dichloropyridine-4-carboxylic acid ethyl ester, 97%, 97% (CAS 1092353-03-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119XUC-250mg |
| cas | 1092353-03-1 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 213.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2,3-dichloropyridine-4-carboxylate (CAS 1092353-03-1) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: ethyl 2,3-dichloropyridine-4-carboxylate. InChIKey: YOOGHVYYXXTYTN-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | ethyl 2,3-dichloropyridine-4-carboxylate |
| InChIKey | YOOGHVYYXXTYTN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=NC=C1)Cl)Cl |
Computed by PubChem (NCBI)