Products 1807013-25-7
CAS 1807013-25-7 appears in our catalog under these names: 4-Amino-2,3-dichloro-benzoic acid methyl ester, 97%, Methyl 4-amino-2,3-dichlorobenzoate 98%, 4-Amino-2,3-dichlorobenzoic acid methyl ester, 98%, 98%, Methyl 4-amino-2,3-dichlorobenzoate, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg, 500mg.
Methyl 4-amino-2,3-dichlorobenzoate (CAS 1807013-25-7) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: methyl 4-amino-2,3-dichlorobenzoate. InChIKey: GRCMPRIJWCTEMT-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | methyl 4-amino-2,3-dichlorobenzoate |
| InChIKey | GRCMPRIJWCTEMT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)N)Cl)Cl |
Computed by PubChem (NCBI)