CAS 138642-40-7 appears in our catalog under these names: Methyl 2,4-dichloro-6-methylnicotinate, 95%, Methyl 2,4-dichloro-6-methylpyridine-3-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
Methyl 2,4-dichloro-6-methylpyridine-3-carboxylate (CAS 138642-40-7) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: methyl 2,4-dichloro-6-methylpyridine-3-carboxylate. InChIKey: LXQZBPLSOSNWJR-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | methyl 2,4-dichloro-6-methylpyridine-3-carboxylate |
| InChIKey | LXQZBPLSOSNWJR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=N1)Cl)C(=O)OC)Cl |
Computed by PubChem (NCBI)