CAS 98968-66-2 appears in our catalog under these names: Methyl 3-amino-2,4-dichlorobenzoate, 98%, Methyl 3-Amino-2,4-dichlorobenzoate, 95+%, Methyl 3–Amino–2,4–dichlorobenzoate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
Methyl 3-amino-2,4-dichlorobenzoate (CAS 98968-66-2) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: methyl 3-amino-2,4-dichlorobenzoate. InChIKey: YPEMWWHAEVJGIS-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | methyl 3-amino-2,4-dichlorobenzoate |
| InChIKey | YPEMWWHAEVJGIS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Cl)N)Cl |
Computed by PubChem (NCBI)