CAS 401566-69-6 appears in our catalog under these names: 5,6-Dichloronicotinic acid ethyl ester, 96%, Ethyl 5,6–Dichloronicotinate, Ethyl 5,6-Dichloronicotinate, >98.0%(GC), Ethyl 5,6-Dichloronicotinate, 98%, 98%, Ethyl 5,6-dichloronicotinate, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg, 10g.
Ethyl 5,6-dichloropyridine-3-carboxylate (CAS 401566-69-6) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: ethyl 5,6-dichloropyridine-3-carboxylate. InChIKey: WGQSPCCCBKQNEV-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | ethyl 5,6-dichloropyridine-3-carboxylate |
| InChIKey | WGQSPCCCBKQNEV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(N=C1)Cl)Cl |
Computed by PubChem (NCBI)