Products 844647-17-2
CAS 844647-17-2 appears in our catalog under these names: Methyl 2-amino-4,5-dichlorobenzoate, Methyl 2-amino-4,5-dichlorobenzoate, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 1g, 10g, 5g.
Methyl 2-amino-4,5-dichlorobenzoate (CAS 844647-17-2) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: methyl 2-amino-4,5-dichlorobenzoate. InChIKey: GPQSHTPSMYICPA-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | methyl 2-amino-4,5-dichlorobenzoate |
| InChIKey | GPQSHTPSMYICPA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1N)Cl)Cl |
Computed by PubChem (NCBI)