Products 52727-62-5
CAS 52727-62-5 is the registry number for Methyl 2-amino-3,5-dichlorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2-amino-3,5-dichlorobenzoate (CAS 52727-62-5) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: methyl 2-amino-3,5-dichlorobenzoate. InChIKey: FODZNORQIATQIP-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | methyl 2-amino-3,5-dichlorobenzoate |
| InChIKey | FODZNORQIATQIP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Cl)Cl)N |
Computed by PubChem (NCBI)
Synonyms:
Methyl 2-amino-3,5-dichlorobenzoate, Methyl 3,5-dichloroanthranilate, 2-Amino-3,5-dichloro-benzoic acid methyl ester, Benzoic acid, 2-amino-3,5-dichloro-, methyl ester, 2-Amino-3,5-dichlorobenzoic acid methyl ester, 2-Amino-3,5-dichloro-benzoic a, methyl 3,5-dichloro-2-aminobenzoate, methyl-2-amino-3,5-dichlorobenzoate, methyl 2-amino-3,5-dichloro-benzoate, Methyl 2-amino-3,5-dichlorobenzoate #