Products 773136-79-1
CAS 773136-79-1 is the registry number for Ethyl 3,5-dichloropyridine-4-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl 3,5-dichloropyridine-4-carboxylate (CAS 773136-79-1) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: ethyl 3,5-dichloropyridine-4-carboxylate. InChIKey: CUQDKCGCSZPIRS-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | ethyl 3,5-dichloropyridine-4-carboxylate |
| InChIKey | CUQDKCGCSZPIRS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=NC=C1Cl)Cl |
Computed by PubChem (NCBI)