Products 1340366-65-5
CAS 1340366-65-5 is the registry number for Methyl-3-amino-2,6-dichloro benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 3-amino-2,6-dichlorobenzoate (CAS 1340366-65-5) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: methyl 3-amino-2,6-dichlorobenzoate. InChIKey: MWUILUHXIZFRLD-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | methyl 3-amino-2,6-dichlorobenzoate |
| InChIKey | MWUILUHXIZFRLD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1Cl)N)Cl |
Computed by PubChem (NCBI)