cas: 2377611-83-9 — see every product listed under this CAS number, including other names
2,3-Difluoro-5-formylphenylboronic acid 96% (CAS 2377611-83-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A778103-250mg |
| cas | 2377611-83-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1010.06 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A778103 |
(2,3-difluoro-5-formylphenyl)boronic acid (CAS 2377611-83-9) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (2,3-difluoro-5-formylphenyl)boronic acid. InChIKey: LAWQGLUQYKXBMD-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O3 |
|---|---|
| Molecular weight | 185.92 g/mol |
| IUPAC name | (2,3-difluoro-5-formylphenyl)boronic acid |
| InChIKey | LAWQGLUQYKXBMD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)F)C=O)(O)O |
Computed by PubChem (NCBI)