Products 1228828-19-0

CAS 1228828-19-0 appears in our catalog under these names: 2,5-Difluoro-4-formylphenylboronic acid, 95%, (2,5-Difluoro-4-formylphenyl)boronic acid 95%, 2,5-Difluoro-4-formylphenylphenylboronic acid, 95%, 95%, (2,5-Difluoro-4-formylphenyl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(2,5-difluoro-4-formylphenyl)boronic acid (CAS 1228828-19-0) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (2,5-difluoro-4-formylphenyl)boronic acid. InChIKey: LTCTYEAWYWPJQG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BF2O3
Molecular weight185.92 g/mol
IUPAC name(2,5-difluoro-4-formylphenyl)boronic acid
InChIKeyLTCTYEAWYWPJQG-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1F)C=O)F)(O)O

Computed by PubChem (NCBI)