Products 1451392-91-8
CAS 1451392-91-8 appears in our catalog under these names: 3,4-Difluoro-2-formylphenylboronic acid, 95%, (3,4-Difluoro-2-formylphenyl)boronic acid 98%, B-(3,4-Difluoro-2-formylphenyl)boronic acid, 98%, 98%, 3,4-Difluoro-2-formylphenylboronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100mg.
(3,4-difluoro-2-formylphenyl)boronic acid (CAS 1451392-91-8) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (3,4-difluoro-2-formylphenyl)boronic acid. InChIKey: LETVLJWTRCPAMR-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O3 |
|---|---|
| Molecular weight | 185.92 g/mol |
| IUPAC name | (3,4-difluoro-2-formylphenyl)boronic acid |
| InChIKey | LETVLJWTRCPAMR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)F)C=O)(O)O |
Computed by PubChem (NCBI)