Products 849062-09-5

CAS 849062-09-5 appears in our catalog under these names: 2,6-Difluoro-3-formylphenylboronic acid, 96%, 2,6–Difluoro–3–formylphenylboronic acid, (2,6-Difluoro-3-formylphenyl)boronic acid 98%, (2,6-Difluoro-3-formylphenyl)boronic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.

Structural formula: {0} (CAS {1})

(2,6-difluoro-3-formylphenyl)boronic acid (CAS 849062-09-5) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (2,6-difluoro-3-formylphenyl)boronic acid. InChIKey: GLQAPMRINNTHGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BF2O3
Molecular weight185.92 g/mol
IUPAC name(2,6-difluoro-3-formylphenyl)boronic acid
InChIKeyGLQAPMRINNTHGJ-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1F)C=O)F)(O)O

Computed by PubChem (NCBI)