CAS 1432610-24-6 appears in our catalog under these names: 4,5-Difluoro-2-formylphenylboronic acid, 95%, 4,5-Difluoro-2-formylphenylboronic acid, 98%, 4,5-Difluoro-2-formylphenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
(4,5-difluoro-2-formylphenyl)boronic acid (CAS 1432610-24-6) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (4,5-difluoro-2-formylphenyl)boronic acid. InChIKey: CDZRCFSCIRPYON-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O3 |
|---|---|
| Molecular weight | 185.92 g/mol |
| IUPAC name | (4,5-difluoro-2-formylphenyl)boronic acid |
| InChIKey | CDZRCFSCIRPYON-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C=O)F)F)(O)O |
Computed by PubChem (NCBI)