Products 1451393-34-2

CAS 1451393-34-2 appears in our catalog under these names: 3,4-Difluoro-5-formylphenylboronic acid, 95%, (3,4-Difluoro-5-formylphenyl)boronic acid, 98%, 3,4-Difluoro-5-formylphenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(3,4-difluoro-5-formylphenyl)boronic acid (CAS 1451393-34-2) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (3,4-difluoro-5-formylphenyl)boronic acid. InChIKey: UZXWYGACIABDHY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BF2O3
Molecular weight185.92 g/mol
IUPAC name(3,4-difluoro-5-formylphenyl)boronic acid
InChIKeyUZXWYGACIABDHY-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)F)F)C=O)(O)O

Computed by PubChem (NCBI)