Products 2377606-10-3

CAS 2377606-10-3 is the registry number for (2,5-difluoro-3-formylphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

(2,5-difluoro-3-formylphenyl)boronic acid (CAS 2377606-10-3) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (2,5-difluoro-3-formylphenyl)boronic acid. InChIKey: AKFWTFPLYNTOEN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BF2O3
Molecular weight185.92 g/mol
IUPAC name(2,5-difluoro-3-formylphenyl)boronic acid
InChIKeyAKFWTFPLYNTOEN-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1F)C=O)F)(O)O

Computed by PubChem (NCBI)