Products 1413393-42-6

CAS 1413393-42-6 appears in our catalog under these names: 2,4-Difluoro-5-formylphenylboronic acid, 98%, (2,4-Difluoro-5-formylphenyl)boronic acid, 97%, 2,4-Difluoro-5-formylphenylboronic acid, ≥95%, ≥95%, (2,4-Difluoro-5-formylphenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

(2,4-difluoro-5-formylphenyl)boronic acid (CAS 1413393-42-6) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (2,4-difluoro-5-formylphenyl)boronic acid. InChIKey: WSZIQXVKISUBRY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BF2O3
Molecular weight185.92 g/mol
IUPAC name(2,4-difluoro-5-formylphenyl)boronic acid
InChIKeyWSZIQXVKISUBRY-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1F)F)C=O)(O)O

Computed by PubChem (NCBI)