CAS 2377611-83-9 appears in our catalog under these names: 2,3-Difluoro-5-formylphenylboronic acid, 96%, 2,3-Difluoro-5-formylphenylboronic acid 96%, 2,3-Difluoro-5-formylphenylboronic acid, 96%, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
(2,3-difluoro-5-formylphenyl)boronic acid (CAS 2377611-83-9) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (2,3-difluoro-5-formylphenyl)boronic acid. InChIKey: LAWQGLUQYKXBMD-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O3 |
|---|---|
| Molecular weight | 185.92 g/mol |
| IUPAC name | (2,3-difluoro-5-formylphenyl)boronic acid |
| InChIKey | LAWQGLUQYKXBMD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)F)C=O)(O)O |
Computed by PubChem (NCBI)