cas: 2271442-87-4 — see every product listed under this CAS number, including other names
2,3-Difluoro-6-(phenylmethoxy)benzoic acid, ≥95%, ≥95% (CAS 2271442-87-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12XDOO-1g |
| cas | 2271442-87-4 |
| size | 1g |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2027.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2,3-difluoro-6-phenylmethoxybenzoic acid (CAS 2271442-87-4) is a chemical compound with the molecular formula C14H10F2O3 and a molecular weight of 264.22 g/mol. IUPAC name: 2,3-difluoro-6-phenylmethoxybenzoic acid. InChIKey: DYGINVGSGHWCKR-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O3 |
|---|---|
| Molecular weight | 264.22 g/mol |
| IUPAC name | 2,3-difluoro-6-phenylmethoxybenzoic acid |
| InChIKey | DYGINVGSGHWCKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)