Products 1365272-82-7

CAS 1365272-82-7 is the registry number for 2-Fluoro-4-(3-fluoro-5-methoxyphenyl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-fluoro-4-(3-fluoro-5-methoxyphenyl)benzoic acid (CAS 1365272-82-7) is a chemical compound with the molecular formula C14H10F2O3 and a molecular weight of 264.22 g/mol. IUPAC name: 2-fluoro-4-(3-fluoro-5-methoxyphenyl)benzoic acid. InChIKey: HCSMPIWFTAVDJH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10F2O3
Molecular weight264.22 g/mol
IUPAC name2-fluoro-4-(3-fluoro-5-methoxyphenyl)benzoic acid
InChIKeyHCSMPIWFTAVDJH-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1)C2=CC(=C(C=C2)C(=O)O)F)F

Computed by PubChem (NCBI)