Products 335140-79-9

CAS 335140-79-9 appears in our catalog under these names: 4-Benzyloxy-2,6-difluorobenzoic acid, 95%, 4-Benzyloxy-2,6-difluorobenzoic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,6-difluoro-4-phenylmethoxybenzoic acid (CAS 335140-79-9) is a chemical compound with the molecular formula C14H10F2O3 and a molecular weight of 264.22 g/mol. IUPAC name: 2,6-difluoro-4-phenylmethoxybenzoic acid. InChIKey: DLMDJHHWRKCELX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10F2O3
Molecular weight264.22 g/mol
IUPAC name2,6-difluoro-4-phenylmethoxybenzoic acid
InChIKeyDLMDJHHWRKCELX-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=CC(=C(C(=C2)F)C(=O)O)F

Computed by PubChem (NCBI)