CAS 335140-79-9 is the registry number for 4-Benzyloxy-2,6-difluorobenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2,6-difluoro-4-phenylmethoxybenzoic acid (CAS 335140-79-9) is a chemical compound with the molecular formula C14H10F2O3 and a molecular weight of 264.22 g/mol. IUPAC name: 2,6-difluoro-4-phenylmethoxybenzoic acid. InChIKey: DLMDJHHWRKCELX-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O3 |
|---|---|
| Molecular weight | 264.22 g/mol |
| IUPAC name | 2,6-difluoro-4-phenylmethoxybenzoic acid |
| InChIKey | DLMDJHHWRKCELX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C(=C2)F)C(=O)O)F |
Computed by PubChem (NCBI)