Products 144292-54-6
CAS 144292-54-6 appears in our catalog under these names: 4-(benzyloxy)-2,3-difluorobenzoic acid, 95%, 4-(Benzyloxy)-2,3-difluorobenzoic acid, 95+%, 4-(Benzyloxy)-2,3-difluorobenzoic acid, ≥95%, ≥95%, 4-(Benzyloxy)-2,3-difluorobenzoic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
2,3-difluoro-4-phenylmethoxybenzoic acid (CAS 144292-54-6) is a chemical compound with the molecular formula C14H10F2O3 and a molecular weight of 264.22 g/mol. IUPAC name: 2,3-difluoro-4-phenylmethoxybenzoic acid. InChIKey: LRDUKBLYCQINLX-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O3 |
|---|---|
| Molecular weight | 264.22 g/mol |
| IUPAC name | 2,3-difluoro-4-phenylmethoxybenzoic acid |
| InChIKey | LRDUKBLYCQINLX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)C(=O)O)F)F |
Computed by PubChem (NCBI)