CAS 1637224-62-4 appears in our catalog under these names: 3-(Benzyloxy)-2,4-difluorobenzoic acid, 95%, 3-(Benzyloxy)-2,4-difluorobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2,4-difluoro-3-phenylmethoxybenzoic acid (CAS 1637224-62-4) is a chemical compound with the molecular formula C14H10F2O3 and a molecular weight of 264.22 g/mol. IUPAC name: 2,4-difluoro-3-phenylmethoxybenzoic acid. InChIKey: PNHXVTHBYVKSGN-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O3 |
|---|---|
| Molecular weight | 264.22 g/mol |
| IUPAC name | 2,4-difluoro-3-phenylmethoxybenzoic acid |
| InChIKey | PNHXVTHBYVKSGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2F)C(=O)O)F |
Computed by PubChem (NCBI)