Products 2276098-34-9
CAS 2276098-34-9 appears in our catalog under these names: 2-(Benzyloxy)-3,4-difluorobenzoic acid, 95%, 2-(Benzyloxy)-3,4-difluorobenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg.
3,4-difluoro-2-phenylmethoxybenzoic acid (CAS 2276098-34-9) is a chemical compound with the molecular formula C14H10F2O3 and a molecular weight of 264.22 g/mol. IUPAC name: 3,4-difluoro-2-phenylmethoxybenzoic acid. InChIKey: NRANTLXCRFTFED-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O3 |
|---|---|
| Molecular weight | 264.22 g/mol |
| IUPAC name | 3,4-difluoro-2-phenylmethoxybenzoic acid |
| InChIKey | NRANTLXCRFTFED-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2F)F)C(=O)O |
Computed by PubChem (NCBI)