CAS 1408143-67-8 appears in our catalog under these names: 4-(Benzyloxy)-3,5-difluorobenzoic acid, 95%, 4-(Benzyloxy)-3,5-difluorobenzoic acid, 4-(Benzyloxy)-3,5-difluorobenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 0,5g.
3,5-difluoro-4-phenylmethoxybenzoic acid (CAS 1408143-67-8) is a chemical compound with the molecular formula C14H10F2O3 and a molecular weight of 264.22 g/mol. IUPAC name: 3,5-difluoro-4-phenylmethoxybenzoic acid. InChIKey: CYRLDNFWXYDSQD-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O3 |
|---|---|
| Molecular weight | 264.22 g/mol |
| IUPAC name | 3,5-difluoro-4-phenylmethoxybenzoic acid |
| InChIKey | CYRLDNFWXYDSQD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2F)C(=O)O)F |
Computed by PubChem (NCBI)