Products 2271442-87-4
CAS 2271442-87-4 appears in our catalog under these names: 2,3-Difluoro-6-(phenylmethoxy)benzoic acid, 95%, 6-(Benzyloxy)-2,3-difluorobenzoic acid, 98%, 2,3-Difluoro-6-(phenylmethoxy)benzoic acid, ≥95%, ≥95%, 2,3-Difluoro-6-(phenylmethoxy)benzoic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2,3-difluoro-6-phenylmethoxybenzoic acid (CAS 2271442-87-4) is a chemical compound with the molecular formula C14H10F2O3 and a molecular weight of 264.22 g/mol. IUPAC name: 2,3-difluoro-6-phenylmethoxybenzoic acid. InChIKey: DYGINVGSGHWCKR-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O3 |
|---|---|
| Molecular weight | 264.22 g/mol |
| IUPAC name | 2,3-difluoro-6-phenylmethoxybenzoic acid |
| InChIKey | DYGINVGSGHWCKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)