CAS 1421604-28-5 appears in our catalog under these names: 3-(Benzyloxy)-2,6-difluorobenzoic acid, 95%, 3-(Benzyloxy)-2,6-difluorobenzoic acid, 97%, 3-(Benzyloxy)-2,6-difluorobenzoic acid, 3-(Benzyloxy)-2,6-difluorobenzoic acid, ≥95%, ≥95%, 3-(Benzyloxy)-2,6-difluorobenzoic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 50mg, 0,5g.
2,6-difluoro-3-phenylmethoxybenzoic acid (CAS 1421604-28-5) is a chemical compound with the molecular formula C14H10F2O3 and a molecular weight of 264.22 g/mol. IUPAC name: 2,6-difluoro-3-phenylmethoxybenzoic acid. InChIKey: CBLROWGOGJMTRS-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O3 |
|---|---|
| Molecular weight | 264.22 g/mol |
| IUPAC name | 2,6-difluoro-3-phenylmethoxybenzoic acid |
| InChIKey | CBLROWGOGJMTRS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)F)C(=O)O)F |
Computed by PubChem (NCBI)