cas: 3663-80-7 — see every product listed under this CAS number, including other names
2,3-Dihydrobenzo[b][1,4]dioxine-2-carboxylic acid, 98%, 98% (CAS 3663-80-7) is a chemical reagent available from Chemat. Available pack sizes: 250g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DME-250g |
| cas | 3663-80-7 |
| size | 250g |
| availability | 798g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 477.20 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 112.40 Pln | |
| Chemat | 100g | 246.80 Pln | |
| Chemat | 500g | 888.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (CAS 3663-80-7) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-3-carboxylic acid. InChIKey: HMBHAQMOBKLWRX-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
| InChIKey | HMBHAQMOBKLWRX-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2O1)C(=O)O |
Computed by PubChem (NCBI)