cas: 953408-82-7 — see every product listed under this CAS number, including other names
2,3-Dihydrobenzofuran-7-sulfonyl chloride, 95% (CAS 953408-82-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A863357-10g |
| cas | 953408-82-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 9210.04 Pln | |
| AmBeed | 5g | 6163.36 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,3-dihydro-1-benzofuran-7-sulfonyl chloride (CAS 953408-82-7) is a chemical compound with the molecular formula C8H7ClO3S and a molecular weight of 218.66 g/mol. IUPAC name: 2,3-dihydro-1-benzofuran-7-sulfonyl chloride. InChIKey: UNECAYDZDLGSLP-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3S |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | 2,3-dihydro-1-benzofuran-7-sulfonyl chloride |
| InChIKey | UNECAYDZDLGSLP-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=CC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)